C22H17ClN4O4 — CID 23494057
8-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]oxy-2-methylquinoline (PubChem CID 23494057) has the molecular formula C22H17ClN4O4 and a molecular weight of 436.86 g/mol. Its IUPAC name is 8-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]oxy-2-methylquinoline.
| Compound Name | 8-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]oxy-2-methylquinoline |
|---|---|
| PubChem CID | 23494057 |
| Molecular Formula | C22H17ClN4O4 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 8-[6-(4-chloro-3,5-dimethylphenoxy)-5-nitropyrimidin-4-yl]oxy-2-methylquinoline |
| SMILES | Cc1ccc2cccc(Oc3ncnc(Oc4cc(C)c(Cl)c(C)c4)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C22H17ClN4O4/c1-12-9-16(10-13(2)18(12)23)30-21-20(27(28)29)22(25-11-24-21)31-17-6-4-5-15-8-7-14(3)26-19(15)17/h4-11H,1-3H3 |
| InChIKey | BKXGBVQTIHUVNY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 100.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|