C26H26N6O3 — CID 23494065
8-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxy-2-methylquinoline (PubChem CID 23494065) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 8-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxy-2-methylquinoline.
| Compound Name | 8-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxy-2-methylquinoline |
|---|---|
| PubChem CID | 23494065 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 8-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]oxy-2-methylquinoline |
| SMILES | Cc1ccc2cccc(Oc3ncnc(N4CCN(c5cccc(C)c5C)CC4)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C26H26N6O3/c1-17-6-4-8-21(19(17)3)30-12-14-31(15-13-30)25-24(32(33)34)26(28-16-27-25)35-22-9-5-7-20-11-10-18(2)29-23(20)22/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | NVEQSYWWODVLAN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|