C31H28N6O3 — CID 23491526
8-[6-(4-benzhydrylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxy-2-methylquinoline (PubChem CID 23491526) has the molecular formula C31H28N6O3 and a molecular weight of 532.60 g/mol. Its IUPAC name is 8-[6-(4-benzhydrylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxy-2-methylquinoline.
| Compound Name | 8-[6-(4-benzhydrylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxy-2-methylquinoline |
|---|---|
| PubChem CID | 23491526 |
| Molecular Formula | C31H28N6O3 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 8-[6-(4-benzhydrylpiperazin-1-yl)-5-nitropyrimidin-4-yl]oxy-2-methylquinoline |
| SMILES | Cc1ccc2cccc(Oc3ncnc(N4CCN(C(c5ccccc5)c5ccccc5)CC4)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C31H28N6O3/c1-22-15-16-23-13-8-14-26(27(23)34-22)40-31-29(37(38)39)30(32-21-33-31)36-19-17-35(18-20-36)28(24-9-4-2-5-10-24)25-11-6-3-7-12-25/h2-16,21,28H,17-20H2,1H3 |
| InChIKey | LFOXOEFMNKSYGE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|