C22H18N6O4 — CID 23494060
N-[4-[[6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 23494060) has the molecular formula C22H18N6O4 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[4-[[6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 23494060 |
| Molecular Formula | C22H18N6O4 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[4-[[6-(2-methylquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ncnc(Oc3cccc4ccc(C)nc34)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N6O4/c1-13-6-7-15-4-3-5-18(19(15)25-13)32-22-20(28(30)31)21(23-12-24-22)27-17-10-8-16(9-11-17)26-14(2)29/h3-12H,1-2H3,(H,26,29)(H,23,24,27) |
| InChIKey | JOODWGDOZRNDKR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 132.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|