C22H20N6O2 — CID 19141998
N-[4-[[5-amino-6-(2-methylquinolin-8-yl)oxypyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 19141998) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[4-[[5-amino-6-(2-methylquinolin-8-yl)oxypyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[5-amino-6-(2-methylquinolin-8-yl)oxypyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 19141998 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[4-[[5-amino-6-(2-methylquinolin-8-yl)oxypyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ncnc(Oc3cccc4ccc(C)nc34)c2N)cc1 |
| InChI | InChI=1S/C22H20N6O2/c1-13-6-7-15-4-3-5-18(20(15)26-13)30-22-19(23)21(24-12-25-22)28-17-10-8-16(9-11-17)27-14(2)29/h3-12H,23H2,1-2H3,(H,27,29)(H,24,25,28) |
| InChIKey | SNRQFVAFFVPBHG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |