C24H27N5O — CID 19141897
4-N-(1-adamantyl)-6-(2-methylquinolin-8-yl)oxypyrimidine-4,5-diamine (PubChem CID 19141897) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-N-(1-adamantyl)-6-(2-methylquinolin-8-yl)oxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(1-adamantyl)-6-(2-methylquinolin-8-yl)oxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19141897 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-N-(1-adamantyl)-6-(2-methylquinolin-8-yl)oxypyrimidine-4,5-diamine |
| SMILES | Cc1ccc2cccc(Oc3ncnc(NC45CC6CC(CC(C6)C4)C5)c3N)c2n1 |
| InChI | InChI=1S/C24H27N5O/c1-14-5-6-18-3-2-4-19(21(18)28-14)30-23-20(25)22(26-13-27-23)29-24-10-15-7-16(11-24)9-17(8-15)12-24/h2-6,13,15-17H,7-12,25H2,1H3,(H,26,27,29) |
| InChIKey | YLYJGTNSSDCGIQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |