C23H21N5O3 — CID 19142000
ethyl 3-[[5-amino-6-(2-methylquinolin-8-yl)oxypyrimidin-4-yl]amino]benzoate (PubChem CID 19142000) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is ethyl 3-[[5-amino-6-(2-methylquinolin-8-yl)oxypyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[5-amino-6-(2-methylquinolin-8-yl)oxypyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19142000 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 3-[[5-amino-6-(2-methylquinolin-8-yl)oxypyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(Oc3cccc4ccc(C)nc34)c2N)c1 |
| InChI | InChI=1S/C23H21N5O3/c1-3-30-23(29)16-7-4-8-17(12-16)28-21-19(24)22(26-13-25-21)31-18-9-5-6-15-11-10-14(2)27-20(15)18/h4-13H,3,24H2,1-2H3,(H,25,26,28) |
| InChIKey | NJMLQGWFQNYLBF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |