C20H16N6O3 — CID 23481270
6-(2-methylquinolin-8-yl)oxy-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 23481270) has the molecular formula C20H16N6O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is 6-(2-methylquinolin-8-yl)oxy-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-(2-methylquinolin-8-yl)oxy-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23481270 |
| Molecular Formula | C20H16N6O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 6-(2-methylquinolin-8-yl)oxy-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1ccc2cccc(Oc3ncnc(NCc4cccnc4)c3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C20H16N6O3/c1-13-7-8-15-5-2-6-16(17(15)25-13)29-20-18(26(27)28)19(23-12-24-20)22-11-14-4-3-9-21-10-14/h2-10,12H,11H2,1H3,(H,22,23,24) |
| InChIKey | VMDHDZRQHFDYBW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|