C16H12BrN5O3 — CID 23481425
6-(4-bromophenoxy)-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 23481425) has the molecular formula C16H12BrN5O3 and a molecular weight of 402.21 g/mol. Its IUPAC name is 6-(4-bromophenoxy)-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-(4-bromophenoxy)-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23481425 |
| Molecular Formula | C16H12BrN5O3 |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 6-(4-bromophenoxy)-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2cccnc2)ncnc1Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrN5O3/c17-12-3-5-13(6-4-12)25-16-14(22(23)24)15(20-10-21-16)19-9-11-2-1-7-18-8-11/h1-8,10H,9H2,(H,19,20,21) |
| InChIKey | XTXPBCPFIQNUHN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|