C13H11BrN4O3 — CID 23488053
6-(4-bromophenoxy)-5-nitro-N-prop-2-enylpyrimidin-4-amine (PubChem CID 23488053) has the molecular formula C13H11BrN4O3 and a molecular weight of 351.16 g/mol. Its IUPAC name is 6-(4-bromophenoxy)-5-nitro-N-prop-2-enylpyrimidin-4-amine.
| Compound Name | 6-(4-bromophenoxy)-5-nitro-N-prop-2-enylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23488053 |
| Molecular Formula | C13H11BrN4O3 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 6-(4-bromophenoxy)-5-nitro-N-prop-2-enylpyrimidin-4-amine |
| SMILES | C=CCNc1ncnc(Oc2ccc(Br)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11BrN4O3/c1-2-7-15-12-11(18(19)20)13(17-8-16-12)21-10-5-3-9(14)4-6-10/h2-6,8H,1,7H2,(H,15,16,17) |
| InChIKey | ZCOBUQDXGKRWRB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|