C26H19N5O3 — CID 23493844
N-benzhydryl-5-nitro-6-quinolin-8-yloxypyrimidin-4-amine (PubChem CID 23493844) has the molecular formula C26H19N5O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is N-benzhydryl-5-nitro-6-quinolin-8-yloxypyrimidin-4-amine.
| Compound Name | N-benzhydryl-5-nitro-6-quinolin-8-yloxypyrimidin-4-amine |
|---|---|
| PubChem CID | 23493844 |
| Molecular Formula | C26H19N5O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-benzhydryl-5-nitro-6-quinolin-8-yloxypyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NC(c2ccccc2)c2ccccc2)ncnc1Oc1cccc2cccnc12 |
| InChI | InChI=1S/C26H19N5O3/c32-31(33)24-25(30-22(18-9-3-1-4-10-18)19-11-5-2-6-12-19)28-17-29-26(24)34-21-15-7-13-20-14-8-16-27-23(20)21/h1-17,22H,(H,28,29,30) |
| InChIKey | XUCNUBVNXYGPGK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|