C23H24N4O3 — CID 22534595
N-benzhydryl-6-cyclohexyloxy-5-nitropyrimidin-4-amine (PubChem CID 22534595) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-benzhydryl-6-cyclohexyloxy-5-nitropyrimidin-4-amine.
| Compound Name | N-benzhydryl-6-cyclohexyloxy-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22534595 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-benzhydryl-6-cyclohexyloxy-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NC(c2ccccc2)c2ccccc2)ncnc1OC1CCCCC1 |
| InChI | InChI=1S/C23H24N4O3/c28-27(29)21-22(24-16-25-23(21)30-19-14-8-3-9-15-19)26-20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-2,4-7,10-13,16,19-20H,3,8-9,14-15H2,(H,24,25,26) |
| InChIKey | UPJDTBVXHUFBGA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|