C15H16BrN5O3 — CID 22531392
N-(5-bromo-2-pyridinyl)-6-cyclohexyloxy-5-nitropyrimidin-4-amine (PubChem CID 22531392) has the molecular formula C15H16BrN5O3 and a molecular weight of 394.23 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-6-cyclohexyloxy-5-nitropyrimidin-4-amine.
| Compound Name | N-(5-bromo-2-pyridinyl)-6-cyclohexyloxy-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22531392 |
| Molecular Formula | C15H16BrN5O3 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-6-cyclohexyloxy-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Br)cn2)ncnc1OC1CCCCC1 |
| InChI | InChI=1S/C15H16BrN5O3/c16-10-6-7-12(17-8-10)20-14-13(21(22)23)15(19-9-18-14)24-11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H,17,18,19,20) |
| InChIKey | PACYKIVIYRQARJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|