C17H20N4O3 — CID 23488246
N-benzyl-6-cyclohexyloxy-5-nitropyrimidin-4-amine (PubChem CID 23488246) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-benzyl-6-cyclohexyloxy-5-nitropyrimidin-4-amine.
| Compound Name | N-benzyl-6-cyclohexyloxy-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23488246 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-benzyl-6-cyclohexyloxy-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccccc2)ncnc1OC1CCCCC1 |
| InChI | InChI=1S/C17H20N4O3/c22-21(23)15-16(18-11-13-7-3-1-4-8-13)19-12-20-17(15)24-14-9-5-2-6-10-14/h1,3-4,7-8,12,14H,2,5-6,9-11H2,(H,18,19,20) |
| InChIKey | LZOYWVBKXFAFQS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|