C20H12BrN7O6 — CID 22536029
N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22536029) has the molecular formula C20H12BrN7O6 and a molecular weight of 526.26 g/mol. Its IUPAC name is N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22536029 |
| Molecular Formula | C20H12BrN7O6 |
| Molecular Weight | 526.26 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | O=C(NNc1ncnc(Oc2ccc(Br)c3cccnc23)c1[N+](=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H12BrN7O6/c21-14-6-7-15(16-13(14)5-2-8-22-16)34-20-17(28(32)33)18(23-10-24-20)25-26-19(29)11-3-1-4-12(9-11)27(30)31/h1-10H,(H,26,29)(H,23,24,25) |
| InChIKey | KIMBKWXOORJBHP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 175.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|