C21H13BrCl2N6O5 — CID 22537169
N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 22537169) has the molecular formula C21H13BrCl2N6O5 and a molecular weight of 580.18 g/mol. Its IUPAC name is N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 22537169 |
| Molecular Formula | C21H13BrCl2N6O5 |
| Molecular Weight | 580.18 g/mol |
| Exact Mass | 577.95 |
| IUPAC Name | N'-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NNc1ncnc(Oc2ccc(Br)c3cccnc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H13BrCl2N6O5/c22-13-4-6-16(18-12(13)2-1-7-25-18)35-21-19(30(32)33)20(26-10-27-21)29-28-17(31)9-34-15-5-3-11(23)8-14(15)24/h1-8,10H,9H2,(H,28,31)(H,26,27,29) |
| InChIKey | ZBQPZYQDHJFPPW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.18 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|