C20H10BrClF3N5O3 — CID 22537591
6-(5-bromoquinolin-8-yl)oxy-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-nitropyrimidin-4-amine (PubChem CID 22537591) has the molecular formula C20H10BrClF3N5O3 and a molecular weight of 540.68 g/mol. Its IUPAC name is 6-(5-bromoquinolin-8-yl)oxy-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-(5-bromoquinolin-8-yl)oxy-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22537591 |
| Molecular Formula | C20H10BrClF3N5O3 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 538.96 |
| IUPAC Name | 6-(5-bromoquinolin-8-yl)oxy-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Cl)c(C(F)(F)F)c2)ncnc1Oc1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C20H10BrClF3N5O3/c21-13-4-6-15(16-11(13)2-1-7-26-16)33-19-17(30(31)32)18(27-9-28-19)29-10-3-5-14(22)12(8-10)20(23,24)25/h1-9H,(H,27,28,29) |
| InChIKey | LEFGKDBXUYTMHY-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|