C20H13BrFN5O3 — CID 22537609
6-(5-bromoquinolin-8-yl)oxy-N-[(4-fluorophenyl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 22537609) has the molecular formula C20H13BrFN5O3 and a molecular weight of 470.26 g/mol. Its IUPAC name is 6-(5-bromoquinolin-8-yl)oxy-N-[(4-fluorophenyl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-(5-bromoquinolin-8-yl)oxy-N-[(4-fluorophenyl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22537609 |
| Molecular Formula | C20H13BrFN5O3 |
| Molecular Weight | 470.26 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 6-(5-bromoquinolin-8-yl)oxy-N-[(4-fluorophenyl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccc(F)cc2)ncnc1Oc1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C20H13BrFN5O3/c21-15-7-8-16(17-14(15)2-1-9-23-17)30-20-18(27(28)29)19(25-11-26-20)24-10-12-3-5-13(22)6-4-12/h1-9,11H,10H2,(H,24,25,26) |
| InChIKey | DYAABKXDTBDEOP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|