C19H19FN6O — CID 19150924
N'-[5-amino-6-[(4-fluorophenyl)methylamino]pyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 19150924) has the molecular formula C19H19FN6O and a molecular weight of 366.40 g/mol. Its IUPAC name is N'-[5-amino-6-[(4-fluorophenyl)methylamino]pyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-[(4-fluorophenyl)methylamino]pyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 19150924 |
| Molecular Formula | C19H19FN6O |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N'-[5-amino-6-[(4-fluorophenyl)methylamino]pyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(NCc2ccc(F)cc2)c1N |
| InChI | InChI=1S/C19H19FN6O/c1-12-4-2-3-5-15(12)19(27)26-25-18-16(21)17(23-11-24-18)22-10-13-6-8-14(20)9-7-13/h2-9,11H,10,21H2,1H3,(H,26,27)(H2,22,23,24,25) |
| InChIKey | TXXSMVHCTLODSP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|