C18H25N7O2 — CID 19150929
N'-[5-amino-6-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-2-methylbenzohydrazide (PubChem CID 19150929) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is N'-[5-amino-6-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-2-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 19150929 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N'-[5-amino-6-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(NCCN2CCOCC2)c1N |
| InChI | InChI=1S/C18H25N7O2/c1-13-4-2-3-5-14(13)18(26)24-23-17-15(19)16(21-12-22-17)20-6-7-25-8-10-27-11-9-25/h2-5,12H,6-11,19H2,1H3,(H,24,26)(H2,20,21,22,23) |
| InChIKey | PKZFDAXKZDFJQH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|