C16H23N7O2 — CID 19143794
N'-[5-amino-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 19143794) has the molecular formula C16H23N7O2 and a molecular weight of 345.41 g/mol. Its IUPAC name is N'-[5-amino-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 19143794 |
| Molecular Formula | C16H23N7O2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N'-[5-amino-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | Nc1c(NCCN2CCCCC2)ncnc1NNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H23N7O2/c17-13-14(18-6-9-23-7-2-1-3-8-23)19-11-20-15(13)21-22-16(24)12-5-4-10-25-12/h4-5,10-11H,1-3,6-9,17H2,(H,22,24)(H2,18,19,20,21) |
| InChIKey | YGIKIGBREUWDSS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|