C17H26N6O2 — CID 19141013
N'-[5-amino-6-[bis(2-methylpropyl)amino]pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 19141013) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is N'-[5-amino-6-[bis(2-methylpropyl)amino]pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-[bis(2-methylpropyl)amino]pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 19141013 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N'-[5-amino-6-[bis(2-methylpropyl)amino]pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | CC(C)CN(CC(C)C)c1ncnc(NNC(=O)c2ccco2)c1N |
| InChI | InChI=1S/C17H26N6O2/c1-11(2)8-23(9-12(3)4)16-14(18)15(19-10-20-16)21-22-17(24)13-6-5-7-25-13/h5-7,10-12H,8-9,18H2,1-4H3,(H,22,24)(H,19,20,21) |
| InChIKey | QHMFFKLQJIYAPV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|