C15H12Cl2N6O2 — CID 19146753
N'-[5-amino-6-(2,5-dichloroanilino)pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 19146753) has the molecular formula C15H12Cl2N6O2 and a molecular weight of 379.21 g/mol. Its IUPAC name is N'-[5-amino-6-(2,5-dichloroanilino)pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-(2,5-dichloroanilino)pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 19146753 |
| Molecular Formula | C15H12Cl2N6O2 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N'-[5-amino-6-(2,5-dichloroanilino)pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccco2)ncnc1Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2N6O2/c16-8-3-4-9(17)10(6-8)21-13-12(18)14(20-7-19-13)22-23-15(24)11-2-1-5-25-11/h1-7H,18H2,(H,23,24)(H2,19,20,21,22) |
| InChIKey | VFNWXFKFLSKZDQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|