C14H12ClN7O2 — CID 19147119
N'-[5-amino-6-[(5-chloro-2-pyridinyl)amino]pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 19147119) has the molecular formula C14H12ClN7O2 and a molecular weight of 345.75 g/mol. Its IUPAC name is N'-[5-amino-6-[(5-chloro-2-pyridinyl)amino]pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-[(5-chloro-2-pyridinyl)amino]pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 19147119 |
| Molecular Formula | C14H12ClN7O2 |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N'-[5-amino-6-[(5-chloro-2-pyridinyl)amino]pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccco2)ncnc1Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H12ClN7O2/c15-8-3-4-10(17-6-8)20-12-11(16)13(19-7-18-12)21-22-14(23)9-2-1-5-24-9/h1-7H,16H2,(H,22,23)(H2,17,18,19,20,21) |
| InChIKey | OROGHOULINTFGE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|