C22H20N6O2 — CID 19150190
N'-[5-amino-6-(benzhydrylamino)pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 19150190) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is N'-[5-amino-6-(benzhydrylamino)pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-(benzhydrylamino)pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 19150190 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N'-[5-amino-6-(benzhydrylamino)pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccco2)ncnc1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N6O2/c23-18-20(24-14-25-21(18)27-28-22(29)17-12-7-13-30-17)26-19(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14,19H,23H2,(H,28,29)(H2,24,25,26,27) |
| InChIKey | FDODMIFGULWLLW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|