C16H20N6O4 — CID 19152070
methyl 1-[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 19152070) has the molecular formula C16H20N6O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 1-[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19152070 |
| Molecular Formula | C16H20N6O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | methyl 1-[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(NNC(=O)c3ccco3)c2N)CC1 |
| InChI | InChI=1S/C16H20N6O4/c1-25-16(24)10-4-6-22(7-5-10)14-12(17)13(18-9-19-14)20-21-15(23)11-3-2-8-26-11/h2-3,8-10H,4-7,17H2,1H3,(H,21,23)(H,18,19,20) |
| InChIKey | RHPHMZGOQIDTNO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|