C17H22N6O4 — CID 19142289
ethyl 1-[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142289) has the molecular formula C17H22N6O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142289 |
| Molecular Formula | C17H22N6O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | ethyl 1-[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(NNC(=O)c3ccco3)c2N)C1 |
| InChI | InChI=1S/C17H22N6O4/c1-2-26-17(25)11-5-3-7-23(9-11)15-13(18)14(19-10-20-15)21-22-16(24)12-6-4-8-27-12/h4,6,8,10-11H,2-3,5,7,9,18H2,1H3,(H,22,24)(H,19,20,21) |
| InChIKey | KHOHTTGJEZKNGI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|