C21H27N5O4 — CID 19142313
ethyl 1-[5-amino-6-(3-ethoxycarbonylanilino)pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142313) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-(3-ethoxycarbonylanilino)pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-(3-ethoxycarbonylanilino)pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142313 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | ethyl 1-[5-amino-6-(3-ethoxycarbonylanilino)pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(N3CCCC(C(=O)OCC)C3)c2N)c1 |
| InChI | InChI=1S/C21H27N5O4/c1-3-29-20(27)14-7-5-9-16(11-14)25-18-17(22)19(24-13-23-18)26-10-6-8-15(12-26)21(28)30-4-2/h5,7,9,11,13,15H,3-4,6,8,10,12,22H2,1-2H3,(H,23,24,25) |
| InChIKey | SWJYPNKDSFOCOK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |