C20H27N5O2 — CID 22544075
ethyl 1-[5-amino-6-(2-ethylanilino)pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 22544075) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-(2-ethylanilino)pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-(2-ethylanilino)pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 22544075 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | ethyl 1-[5-amino-6-(2-ethylanilino)pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Nc3ccccc3CC)c2N)C1 |
| InChI | InChI=1S/C20H27N5O2/c1-3-14-8-5-6-10-16(14)24-18-17(21)19(23-13-22-18)25-11-7-9-15(12-25)20(26)27-4-2/h5-6,8,10,13,15H,3-4,7,9,11-12,21H2,1-2H3,(H,22,23,24) |
| InChIKey | YVGIHTRZOSPDTA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |