C19H25N5O2 — CID 19142243
ethyl 1-[5-amino-6-(2-methylanilino)pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142243) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-(2-methylanilino)pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-(2-methylanilino)pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142243 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | ethyl 1-[5-amino-6-(2-methylanilino)pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Nc3ccccc3C)c2N)C1 |
| InChI | InChI=1S/C19H25N5O2/c1-3-26-19(25)14-8-6-10-24(11-14)18-16(20)17(21-12-22-18)23-15-9-5-4-7-13(15)2/h4-5,7,9,12,14H,3,6,8,10-11,20H2,1-2H3,(H,21,22,23) |
| InChIKey | FCYISBYAOSZUCO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |