C25H29N5O2 — CID 19142266
ethyl 1-[5-amino-6-(benzhydrylamino)pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142266) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-(benzhydrylamino)pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-(benzhydrylamino)pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142266 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | ethyl 1-[5-amino-6-(benzhydrylamino)pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(NC(c3ccccc3)c3ccccc3)c2N)C1 |
| InChI | InChI=1S/C25H29N5O2/c1-2-32-25(31)20-14-9-15-30(16-20)24-21(26)23(27-17-28-24)29-22(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-8,10-13,17,20,22H,2,9,14-16,26H2,1H3,(H,27,28,29) |
| InChIKey | WDTBGRHNTAHGGD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |