C17H21ClN6O2 — CID 19142345
ethyl 1-[5-amino-6-[(2-chloro-3-pyridinyl)amino]pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142345) has the molecular formula C17H21ClN6O2 and a molecular weight of 376.85 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-[(2-chloro-3-pyridinyl)amino]pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-[(2-chloro-3-pyridinyl)amino]pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142345 |
| Molecular Formula | C17H21ClN6O2 |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | ethyl 1-[5-amino-6-[(2-chloro-3-pyridinyl)amino]pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Nc3cccnc3Cl)c2N)C1 |
| InChI | InChI=1S/C17H21ClN6O2/c1-2-26-17(25)11-5-4-8-24(9-11)16-13(19)15(21-10-22-16)23-12-6-3-7-20-14(12)18/h3,6-7,10-11H,2,4-5,8-9,19H2,1H3,(H,21,22,23) |
| InChIKey | OJOPZEUVDHAHBZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|