C18H23N7O3 — CID 19142287
ethyl 1-[5-amino-6-[2-(pyridine-3-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142287) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-[2-(pyridine-3-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-[2-(pyridine-3-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142287 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | ethyl 1-[5-amino-6-[2-(pyridine-3-carbonyl)hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(NNC(=O)c3cccnc3)c2N)C1 |
| InChI | InChI=1S/C18H23N7O3/c1-2-28-18(27)13-6-4-8-25(10-13)16-14(19)15(21-11-22-16)23-24-17(26)12-5-3-7-20-9-12/h3,5,7,9,11,13H,2,4,6,8,10,19H2,1H3,(H,24,26)(H,21,22,23) |
| InChIKey | SWVGLRYTRPYZJY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|