C20H24Cl2N6O4 — CID 19142294
ethyl 1-[5-amino-6-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142294) has the molecular formula C20H24Cl2N6O4 and a molecular weight of 483.36 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142294 |
| Molecular Formula | C20H24Cl2N6O4 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | ethyl 1-[5-amino-6-[2-[2-(2,4-dichlorophenoxy)acetyl]hydrazinyl]pyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(NNC(=O)COc3ccc(Cl)cc3Cl)c2N)C1 |
| InChI | InChI=1S/C20H24Cl2N6O4/c1-2-31-20(30)12-4-3-7-28(9-12)19-17(23)18(24-11-25-19)27-26-16(29)10-32-15-6-5-13(21)8-14(15)22/h5-6,8,11-12H,2-4,7,9-10,23H2,1H3,(H,26,29)(H,24,25,27) |
| InChIKey | RWDYQDPKCAMVFD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|