C18H20F3N5O2 — CID 19148533
methyl 1-[5-amino-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 19148533) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is methyl 1-[5-amino-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[5-amino-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19148533 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | methyl 1-[5-amino-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2ncnc(Nc3cccc(C(F)(F)F)c3)c2N)CC1 |
| InChI | InChI=1S/C18H20F3N5O2/c1-28-17(27)11-5-7-26(8-6-11)16-14(22)15(23-10-24-16)25-13-4-2-3-12(9-13)18(19,20)21/h2-4,9-11H,5-8,22H2,1H3,(H,23,24,25) |
| InChIKey | BRSUFBDFJJBMFT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |