C17H23N5S — CID 19143766
6-phenylsulfanyl-4-N-(2-piperidin-1-ylethyl)pyrimidine-4,5-diamine (PubChem CID 19143766) has the molecular formula C17H23N5S and a molecular weight of 329.47 g/mol. Its IUPAC name is 6-phenylsulfanyl-4-N-(2-piperidin-1-ylethyl)pyrimidine-4,5-diamine.
| Compound Name | 6-phenylsulfanyl-4-N-(2-piperidin-1-ylethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19143766 |
| Molecular Formula | C17H23N5S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 6-phenylsulfanyl-4-N-(2-piperidin-1-ylethyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(NCCN2CCCCC2)ncnc1Sc1ccccc1 |
| InChI | InChI=1S/C17H23N5S/c18-15-16(19-9-12-22-10-5-2-6-11-22)20-13-21-17(15)23-14-7-3-1-4-8-14/h1,3-4,7-8,13H,2,5-6,9-12,18H2,(H,19,20,21) |
| InChIKey | VZZFXDDKLIXAHS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |