C14H17ClN4S — CID 19134776
4-N-butyl-6-(4-chlorophenyl)sulfanylpyrimidine-4,5-diamine (PubChem CID 19134776) has the molecular formula C14H17ClN4S and a molecular weight of 308.84 g/mol. Its IUPAC name is 4-N-butyl-6-(4-chlorophenyl)sulfanylpyrimidine-4,5-diamine.
| Compound Name | 4-N-butyl-6-(4-chlorophenyl)sulfanylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19134776 |
| Molecular Formula | C14H17ClN4S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-N-butyl-6-(4-chlorophenyl)sulfanylpyrimidine-4,5-diamine |
| SMILES | CCCCNc1ncnc(Sc2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C14H17ClN4S/c1-2-3-8-17-13-12(16)14(19-9-18-13)20-11-6-4-10(15)5-7-11/h4-7,9H,2-3,8,16H2,1H3,(H,17,18,19) |
| InChIKey | MRQSZXSBXTYIKV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|