C15H19N5S — CID 19138241
4-(4-methylpiperazin-1-yl)-6-phenylsulfanylpyrimidin-5-amine (PubChem CID 19138241) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-6-phenylsulfanylpyrimidin-5-amine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-6-phenylsulfanylpyrimidin-5-amine |
|---|---|
| PubChem CID | 19138241 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-phenylsulfanylpyrimidin-5-amine |
| SMILES | CN1CCN(c2ncnc(Sc3ccccc3)c2N)CC1 |
| InChI | InChI=1S/C15H19N5S/c1-19-7-9-20(10-8-19)14-13(16)15(18-11-17-14)21-12-5-3-2-4-6-12/h2-6,11H,7-10,16H2,1H3 |
| InChIKey | JEJFFBNKDPNWEY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |