C16H19ClN4S — CID 19136527
4-(4-chlorophenyl)sulfanyl-6-(4-methylpiperidin-1-yl)pyrimidin-5-amine (PubChem CID 19136527) has the molecular formula C16H19ClN4S and a molecular weight of 334.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-6-(4-methylpiperidin-1-yl)pyrimidin-5-amine.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-6-(4-methylpiperidin-1-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19136527 |
| Molecular Formula | C16H19ClN4S |
| Molecular Weight | 334.88 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-6-(4-methylpiperidin-1-yl)pyrimidin-5-amine |
| SMILES | CC1CCN(c2ncnc(Sc3ccc(Cl)cc3)c2N)CC1 |
| InChI | InChI=1S/C16H19ClN4S/c1-11-6-8-21(9-7-11)15-14(18)16(20-10-19-15)22-13-4-2-12(17)3-5-13/h2-5,10-11H,6-9,18H2,1H3 |
| InChIKey | LIOFRNRIXVSBTG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |