C19H26ClN7 — CID 19138163
4-[4-(3-chlorophenyl)piperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidin-5-amine (PubChem CID 19138163) has the molecular formula C19H26ClN7 and a molecular weight of 387.92 g/mol. Its IUPAC name is 4-[4-(3-chlorophenyl)piperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidin-5-amine.
| Compound Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19138163 |
| Molecular Formula | C19H26ClN7 |
| Molecular Weight | 387.92 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 4-[4-(3-chlorophenyl)piperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidin-5-amine |
| SMILES | CN1CCN(c2ncnc(N3CCN(c4cccc(Cl)c4)CC3)c2N)CC1 |
| InChI | InChI=1S/C19H26ClN7/c1-24-5-7-26(8-6-24)18-17(21)19(23-14-22-18)27-11-9-25(10-12-27)16-4-2-3-15(20)13-16/h2-4,13-14H,5-12,21H2,1H3 |
| InChIKey | HDOHMUJMZMKGNH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.92 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |