C16H20ClN7O — CID 19138262
N'-[5-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 19138262) has the molecular formula C16H20ClN7O and a molecular weight of 361.84 g/mol. Its IUPAC name is N'-[5-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19138262 |
| Molecular Formula | C16H20ClN7O |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N'-[5-amino-6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | CN1CCN(c2ncnc(NNC(=O)c3cccc(Cl)c3)c2N)CC1 |
| InChI | InChI=1S/C16H20ClN7O/c1-23-5-7-24(8-6-23)15-13(18)14(19-10-20-15)21-22-16(25)11-3-2-4-12(17)9-11/h2-4,9-10H,5-8,18H2,1H3,(H,22,25)(H,19,20,21) |
| InChIKey | WORZUURORDOISQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|