C20H20Cl2N8O — CID 19151703
N'-[5-amino-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 19151703) has the molecular formula C20H20Cl2N8O and a molecular weight of 459.34 g/mol. Its IUPAC name is N'-[5-amino-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 19151703 |
| Molecular Formula | C20H20Cl2N8O |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N'-[5-amino-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccc(Cl)cc2Cl)ncnc1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H20Cl2N8O/c21-13-4-5-14(15(22)11-13)20(31)28-27-18-17(23)19(26-12-25-18)30-9-7-29(8-10-30)16-3-1-2-6-24-16/h1-6,11-12H,7-10,23H2,(H,28,31)(H,25,26,27) |
| InChIKey | LVHFNSIYGDDADY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|