C18H24ClN7O — CID 19151567
N'-[5-amino-6-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 19151567) has the molecular formula C18H24ClN7O and a molecular weight of 389.89 g/mol. Its IUPAC name is N'-[5-amino-6-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19151567 |
| Molecular Formula | C18H24ClN7O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N'-[5-amino-6-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | CN1CCC(N(C)c2ncnc(NNC(=O)c3cccc(Cl)c3)c2N)CC1 |
| InChI | InChI=1S/C18H24ClN7O/c1-25-8-6-14(7-9-25)26(2)17-15(20)16(21-11-22-17)23-24-18(27)12-4-3-5-13(19)10-12/h3-5,10-11,14H,6-9,20H2,1-2H3,(H,24,27)(H,21,22,23) |
| InChIKey | WKTMBDOEEZPGOH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|