C17H24N8O — CID 19151861
N'-[5-amino-6-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]pyridine-4-carbohydrazide (PubChem CID 19151861) has the molecular formula C17H24N8O and a molecular weight of 356.43 g/mol. Its IUPAC name is N'-[5-amino-6-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[5-amino-6-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 19151861 |
| Molecular Formula | C17H24N8O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N'-[5-amino-6-[methyl-(1-methylpiperidin-4-yl)amino]pyrimidin-4-yl]pyridine-4-carbohydrazide |
| SMILES | CN1CCC(N(C)c2ncnc(NNC(=O)c3ccncc3)c2N)CC1 |
| InChI | InChI=1S/C17H24N8O/c1-24-9-5-13(6-10-24)25(2)16-14(18)15(20-11-21-16)22-23-17(26)12-3-7-19-8-4-12/h3-4,7-8,11,13H,5-6,9-10,18H2,1-2H3,(H,23,26)(H,20,21,22) |
| InChIKey | UUWOMZLKMJXAND-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|