C17H23IN6 — CID 19148960
6-N-(4-iodophenyl)-4-N-methyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,5,6-triamine (PubChem CID 19148960) has the molecular formula C17H23IN6 and a molecular weight of 438.32 g/mol. Its IUPAC name is 6-N-(4-iodophenyl)-4-N-methyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(4-iodophenyl)-4-N-methyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19148960 |
| Molecular Formula | C17H23IN6 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 6-N-(4-iodophenyl)-4-N-methyl-4-N-(1-methylpiperidin-4-yl)pyrimidine-4,5,6-triamine |
| SMILES | CN1CCC(N(C)c2ncnc(Nc3ccc(I)cc3)c2N)CC1 |
| InChI | InChI=1S/C17H23IN6/c1-23-9-7-14(8-10-23)24(2)17-15(19)16(20-11-21-17)22-13-5-3-12(18)4-6-13/h3-6,11,14H,7-10,19H2,1-2H3,(H,20,21,22) |
| InChIKey | BOMPOXSIUOCXSU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|