C17H23N7O — CID 19140515
N'-[5-amino-6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]pyridine-4-carbohydrazide (PubChem CID 19140515) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is N'-[5-amino-6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[5-amino-6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 19140515 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N'-[5-amino-6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]pyridine-4-carbohydrazide |
| SMILES | CCC1CCCCN1c1ncnc(NNC(=O)c2ccncc2)c1N |
| InChI | InChI=1S/C17H23N7O/c1-2-13-5-3-4-10-24(13)16-14(18)15(20-11-21-16)22-23-17(25)12-6-8-19-9-7-12/h6-9,11,13H,2-5,10,18H2,1H3,(H,23,25)(H,20,21,22) |
| InChIKey | DYWNNJIINSEEPC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|