C17H21BrN6O — CID 19140174
N'-[5-amino-6-(2-methylpiperidin-1-yl)pyrimidin-4-yl]-2-bromobenzohydrazide (PubChem CID 19140174) has the molecular formula C17H21BrN6O and a molecular weight of 405.30 g/mol. Its IUPAC name is N'-[5-amino-6-(2-methylpiperidin-1-yl)pyrimidin-4-yl]-2-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-methylpiperidin-1-yl)pyrimidin-4-yl]-2-bromobenzohydrazide |
|---|---|
| PubChem CID | 19140174 |
| Molecular Formula | C17H21BrN6O |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N'-[5-amino-6-(2-methylpiperidin-1-yl)pyrimidin-4-yl]-2-bromobenzohydrazide |
| SMILES | CC1CCCCN1c1ncnc(NNC(=O)c2ccccc2Br)c1N |
| InChI | InChI=1S/C17H21BrN6O/c1-11-6-4-5-9-24(11)16-14(19)15(20-10-21-16)22-23-17(25)12-7-2-3-8-13(12)18/h2-3,7-8,10-11H,4-6,9,19H2,1H3,(H,23,25)(H,20,21,22) |
| InChIKey | ZANIAXRSKIJCPZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|