C17H22BrN7O2 — CID 19140675
N'-[5-amino-6-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]-2-bromobenzohydrazide (PubChem CID 19140675) has the molecular formula C17H22BrN7O2 and a molecular weight of 436.31 g/mol. Its IUPAC name is N'-[5-amino-6-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]-2-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]-2-bromobenzohydrazide |
|---|---|
| PubChem CID | 19140675 |
| Molecular Formula | C17H22BrN7O2 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N'-[5-amino-6-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]-2-bromobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccc2Br)ncnc1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C17H22BrN7O2/c18-13-4-2-1-3-12(13)17(27)23-22-15-14(19)16(21-11-20-15)25-7-5-24(6-8-25)9-10-26/h1-4,11,26H,5-10,19H2,(H,23,27)(H,20,21,22) |
| InChIKey | WOCCRBILEDZAIW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|