C22H24BrN7O — CID 19139319
N'-[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-2-bromobenzohydrazide (PubChem CID 19139319) has the molecular formula C22H24BrN7O and a molecular weight of 482.39 g/mol. Its IUPAC name is N'-[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-2-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-2-bromobenzohydrazide |
|---|---|
| PubChem CID | 19139319 |
| Molecular Formula | C22H24BrN7O |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | N'-[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]-2-bromobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccc2Br)ncnc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24BrN7O/c23-18-9-5-4-8-17(18)22(31)28-27-20-19(24)21(26-15-25-20)30-12-10-29(11-13-30)14-16-6-2-1-3-7-16/h1-9,15H,10-14,24H2,(H,28,31)(H,25,26,27) |
| InChIKey | OOGPCUFJWLHULV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|