C21H24N8O — CID 19139326
N'-[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 19139326) has the molecular formula C21H24N8O and a molecular weight of 404.48 g/mol. Its IUPAC name is N'-[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 19139326 |
| Molecular Formula | C21H24N8O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N'-[5-amino-6-(4-benzylpiperazin-1-yl)pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2cccnc2)ncnc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N8O/c22-18-19(26-27-21(30)17-7-4-8-23-13-17)24-15-25-20(18)29-11-9-28(10-12-29)14-16-5-2-1-3-6-16/h1-8,13,15H,9-12,14,22H2,(H,27,30)(H,24,25,26) |
| InChIKey | VNLSMNFTFYWRND-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|